C30H30ClNO7S — CID 22081112
3-(4-methylphenyl)sulfonyloxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2,4-dimethylindol-3-yl]acetate (PubChem CID 22081112) has the molecular formula C30H30ClNO7S and a molecular weight of 584.09 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyloxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2,4-dimethylindol-3-yl]acetate.
| Compound Name | 3-(4-methylphenyl)sulfonyloxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2,4-dimethylindol-3-yl]acetate |
|---|---|
| PubChem CID | 22081112 |
| Molecular Formula | C30H30ClNO7S |
| Molecular Weight | 584.09 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyloxypropyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2,4-dimethylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1C)c(CC(=O)OCCCOS(=O)(=O)c1ccc(C)cc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H30ClNO7S/c1-19-6-12-24(13-7-19)40(35,36)39-17-5-16-38-28(33)18-25-21(3)32(30(34)22-8-10-23(31)11-9-22)26-14-15-27(37-4)20(2)29(25)26/h6-15H,5,16-18H2,1-4H3 |
| InChIKey | WWQWOKIBNVVTJL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.09 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|