C30H38ClN3O5 — CID 88624384
[4-[4-(3-hydroxypropyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3,3-dimethylbutanoyl] 4-chlorobenzoate (PubChem CID 88624384) has the molecular formula C30H38ClN3O5 and a molecular weight of 556.10 g/mol. Its IUPAC name is [4-[4-(3-hydroxypropyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3,3-dimethylbutanoyl] 4-chlorobenzoate.
| Compound Name | [4-[4-(3-hydroxypropyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3,3-dimethylbutanoyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 88624384 |
| Molecular Formula | C30H38ClN3O5 |
| Molecular Weight | 556.10 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | [4-[4-(3-hydroxypropyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3,3-dimethylbutanoyl] 4-chlorobenzoate |
| SMILES | COc1ccc2[nH]c(C)c(C(C(=O)OC(=O)c3ccc(Cl)cc3)C(C)(C)CN3CCN(CCCO)CC3)c2c1 |
| InChI | InChI=1S/C30H38ClN3O5/c1-20-26(24-18-23(38-4)10-11-25(24)32-20)27(29(37)39-28(36)21-6-8-22(31)9-7-21)30(2,3)19-34-15-13-33(14-16-34)12-5-17-35/h6-11,18,27,32,35H,5,12-17,19H2,1-4H3 |
| InChIKey | KHWHVZPFNQJPLB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|