C31H40ClN3O5 — CID 88624768
[4-[4-(5-hydroxypentyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3-methylbutanoyl] 4-chlorobenzoate (PubChem CID 88624768) has the molecular formula C31H40ClN3O5 and a molecular weight of 570.13 g/mol. Its IUPAC name is [4-[4-(5-hydroxypentyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3-methylbutanoyl] 4-chlorobenzoate.
| Compound Name | [4-[4-(5-hydroxypentyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3-methylbutanoyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 88624768 |
| Molecular Formula | C31H40ClN3O5 |
| Molecular Weight | 570.13 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | [4-[4-(5-hydroxypentyl)piperazin-1-yl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)-3-methylbutanoyl] 4-chlorobenzoate |
| SMILES | COc1ccc2[nH]c(C)c(C(C(=O)OC(=O)c3ccc(Cl)cc3)C(C)CN3CCN(CCCCCO)CC3)c2c1 |
| InChI | InChI=1S/C31H40ClN3O5/c1-21(20-35-16-14-34(15-17-35)13-5-4-6-18-36)28(31(38)40-30(37)23-7-9-24(32)10-8-23)29-22(2)33-27-12-11-25(39-3)19-26(27)29/h7-12,19,21,28,33,36H,4-6,13-18,20H2,1-3H3 |
| InChIKey | BMQDJKFTRFUIAC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|