C24H22ClN3O4S — CID 54159437
S-[2-[5-[2-(4-chlorophenyl)-1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-oxoethyl]-1,2,4-oxadiazol-3-yl]ethyl] ethanethioate (PubChem CID 54159437) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is S-[2-[5-[2-(4-chlorophenyl)-1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-oxoethyl]-1,2,4-oxadiazol-3-yl]ethyl] ethanethioate.
| Compound Name | S-[2-[5-[2-(4-chlorophenyl)-1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-oxoethyl]-1,2,4-oxadiazol-3-yl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 54159437 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | S-[2-[5-[2-(4-chlorophenyl)-1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-oxoethyl]-1,2,4-oxadiazol-3-yl]ethyl] ethanethioate |
| SMILES | COc1ccc2[nH]c(C)c(C(C(=O)c3ccc(Cl)cc3)c3nc(CCSC(C)=O)no3)c2c1 |
| InChI | InChI=1S/C24H22ClN3O4S/c1-13-21(18-12-17(31-3)8-9-19(18)26-13)22(23(30)15-4-6-16(25)7-5-15)24-27-20(28-32-24)10-11-33-14(2)29/h4-9,12,22,26H,10-11H2,1-3H3 |
| InChIKey | ONJWYJNIQYIMDA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|