C14H14N2O5S — CID 57166633
4-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-4,5-dihydropyrimidine-3,5-dicarboxylic acid (PubChem CID 57166633) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-4,5-dihydropyrimidine-3,5-dicarboxylic acid.
| Compound Name | 4-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-4,5-dihydropyrimidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57166633 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-(2-methoxyphenyl)-6-methyl-2-sulfanylidene-4,5-dihydropyrimidine-3,5-dicarboxylic acid |
| SMILES | COc1ccccc1C1C(C(=O)O)C(C)=NC(=S)N1C(=O)O |
| InChI | InChI=1S/C14H14N2O5S/c1-7-10(12(17)18)11(16(14(19)20)13(22)15-7)8-5-3-4-6-9(8)21-2/h3-6,10-11H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | AQPYLVGGHKXCKB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|