About 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate
2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate (PubChem CID 57166913) has the molecular formula C24H17F7O2
and a molecular weight of 470.38 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate |
| PubChem CID | 57166913 |
| Molecular Formula | C24H17F7O2 |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate |
| SMILES | Cc1cc(F)ccc1-c1ccccc1C(=O)OCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F7O2/c1-14-10-18(25)6-7-19(14)20-4-2-3-5-21(20)22(32)33-9-8-15-11-16(23(26,27)28)13-17(12-15)24(29,30)31/h2-7,10-13H,8-9H2,1H3 |
| InChIKey | HGKOLDDTPIBHNZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate (CID 57166913) is 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate is Cc1cc(F)ccc1-c1ccccc1C(=O)OCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate?
The InChIKey is HGKOLDDTPIBHNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F7O2/c1-14-10-18(25)6-7-19(14)20-4-2-3-5-21(20)22(32)33-9-8-15-11-16(23(26,27)28)13-17(12-15)24(29,30)31/h2-7,10-13H,8-9H2,1H3.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate?
2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate has a molecular weight of 470.38 g/mol, XLogP of 7.24, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]ethyl 2-(4-fluoro-2-methylphenyl)benzoate is sourced from PubChem (CID 57166913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).