C21H24N2O3 — CID 57168808
3-[(4,4-dimethyl-1,5,6,7-tetrahydroindol-2-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one (PubChem CID 57168808) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-1,5,6,7-tetrahydroindol-2-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one.
| Compound Name | 3-[(4,4-dimethyl-1,5,6,7-tetrahydroindol-2-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 57168808 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-[(4,4-dimethyl-1,5,6,7-tetrahydroindol-2-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
| SMILES | COc1cc2c(cc1OC)C(=Cc1cc3c([nH]1)CCCC3(C)C)C(=O)N2 |
| InChI | InChI=1S/C21H24N2O3/c1-21(2)7-5-6-16-15(21)9-12(22-16)8-14-13-10-18(25-3)19(26-4)11-17(13)23-20(14)24/h8-11,22H,5-7H2,1-4H3,(H,23,24) |
| InChIKey | ZYEOVPOOODSOQT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|