C19H25NO3S — CID 57168934
ethyl (2S)-1-sulfanyl-3-[2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetyl]pyrrolidine-2-carboxylate (PubChem CID 57168934) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is ethyl (2S)-1-sulfanyl-3-[2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-sulfanyl-3-[2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57168934 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl (2S)-1-sulfanyl-3-[2-(1,2,3,4-tetrahydronaphthalen-2-yl)acetyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(C(=O)CC2CCc3ccccc3C2)CCN1S |
| InChI | InChI=1S/C19H25NO3S/c1-2-23-19(22)18-16(9-10-20(18)24)17(21)12-13-7-8-14-5-3-4-6-15(14)11-13/h3-6,13,16,18,24H,2,7-12H2,1H3/t13?,16?,18-/m0/s1 |
| InChIKey | KGUCBEFYRBMFNQ-AUCFXJAVSA-N |
| XLogP | 2.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|