C20H30N2O — CID 57169033
2-[2-[6-(2-phenylethylamino)hexyl]pyrrol-2-yl]ethanol (PubChem CID 57169033) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-[2-[6-(2-phenylethylamino)hexyl]pyrrol-2-yl]ethanol.
| Compound Name | 2-[2-[6-(2-phenylethylamino)hexyl]pyrrol-2-yl]ethanol |
|---|---|
| PubChem CID | 57169033 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-[2-[6-(2-phenylethylamino)hexyl]pyrrol-2-yl]ethanol |
| SMILES | OCCC1(CCCCCCNCCc2ccccc2)C=CC=N1 |
| InChI | InChI=1S/C20H30N2O/c23-18-14-20(13-8-16-22-20)12-6-1-2-7-15-21-17-11-19-9-4-3-5-10-19/h3-5,8-10,13,16,21,23H,1-2,6-7,11-12,14-15,17-18H2 |
| InChIKey | WOFPWLNGGRJUCL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|