C16H22N4O2 — CID 57170017
[3-(1H-imidazol-5-yl)-6-phenylhexoxy]urea (PubChem CID 57170017) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [3-(1H-imidazol-5-yl)-6-phenylhexoxy]urea.
| Compound Name | [3-(1H-imidazol-5-yl)-6-phenylhexoxy]urea |
|---|---|
| PubChem CID | 57170017 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [3-(1H-imidazol-5-yl)-6-phenylhexoxy]urea |
| SMILES | NC(=O)NOCCC(CCCc1ccccc1)c1cnc[nH]1 |
| InChI | InChI=1S/C16H22N4O2/c17-16(21)20-22-10-9-14(15-11-18-12-19-15)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,11-12,14H,4,7-10H2,(H,18,19)(H3,17,20,21) |
| InChIKey | IFJAIDNGGACOCK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|