About (1-ethylindol-5-yl) acetate
(1-ethylindol-5-yl) acetate (PubChem CID 57170525) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is (1-ethylindol-5-yl) acetate.
Molecular Properties
| Compound Name | (1-ethylindol-5-yl) acetate |
| PubChem CID | 57170525 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (1-ethylindol-5-yl) acetate |
| SMILES | CCn1ccc2cc(OC(C)=O)ccc21 |
| InChI | InChI=1S/C12H13NO2/c1-3-13-7-6-10-8-11(15-9(2)14)4-5-12(10)13/h4-8H,3H2,1-2H3 |
| InChIKey | RBJDSYUCHPZMQY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylindol-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylindol-5-yl) acetate?
The IUPAC name of (1-ethylindol-5-yl) acetate (CID 57170525) is (1-ethylindol-5-yl) acetate.
What is the SMILES notation for (1-ethylindol-5-yl) acetate?
The canonical SMILES for (1-ethylindol-5-yl) acetate is CCn1ccc2cc(OC(C)=O)ccc21.
What is the InChIKey of (1-ethylindol-5-yl) acetate?
The InChIKey is RBJDSYUCHPZMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-3-13-7-6-10-8-11(15-9(2)14)4-5-12(10)13/h4-8H,3H2,1-2H3.
What are the key properties of (1-ethylindol-5-yl) acetate?
(1-ethylindol-5-yl) acetate has a molecular weight of 203.24 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylindol-5-yl) acetate is sourced from PubChem (CID 57170525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).