About (1-ethylindol-5-yl) hypoiodite
(1-ethylindol-5-yl) hypoiodite (PubChem CID 23151406) has the molecular formula C10H10INO
and a molecular weight of 287.10 g/mol. Its IUPAC name is (1-ethylindol-5-yl) hypoiodite.
Molecular Properties
| Compound Name | (1-ethylindol-5-yl) hypoiodite |
| PubChem CID | 23151406 |
| Molecular Formula | C10H10INO |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | (1-ethylindol-5-yl) hypoiodite |
| SMILES | CCn1ccc2cc(OI)ccc21 |
| InChI | InChI=1S/C10H10INO/c1-2-12-6-5-8-7-9(13-11)3-4-10(8)12/h3-7H,2H2,1H3 |
| InChIKey | JYMNLWYYHLCLJW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylindol-5-yl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylindol-5-yl) hypoiodite?
The IUPAC name of (1-ethylindol-5-yl) hypoiodite (CID 23151406) is (1-ethylindol-5-yl) hypoiodite.
What is the SMILES notation for (1-ethylindol-5-yl) hypoiodite?
The canonical SMILES for (1-ethylindol-5-yl) hypoiodite is CCn1ccc2cc(OI)ccc21.
What is the InChIKey of (1-ethylindol-5-yl) hypoiodite?
The InChIKey is JYMNLWYYHLCLJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10INO/c1-2-12-6-5-8-7-9(13-11)3-4-10(8)12/h3-7H,2H2,1H3.
What are the key properties of (1-ethylindol-5-yl) hypoiodite?
(1-ethylindol-5-yl) hypoiodite has a molecular weight of 287.10 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylindol-5-yl) hypoiodite is sourced from PubChem (CID 23151406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).