C13H14FN3O3 — CID 57171016
1-[(1S)-3-[(4-fluorophenyl)methoxyamino]cyclopenta-2,4-dien-1-yl]-1-hydroxyurea (PubChem CID 57171016) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 1-[(1S)-3-[(4-fluorophenyl)methoxyamino]cyclopenta-2,4-dien-1-yl]-1-hydroxyurea.
| Compound Name | 1-[(1S)-3-[(4-fluorophenyl)methoxyamino]cyclopenta-2,4-dien-1-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 57171016 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-[(1S)-3-[(4-fluorophenyl)methoxyamino]cyclopenta-2,4-dien-1-yl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)[C@H]1C=CC(NOCc2ccc(F)cc2)=C1 |
| InChI | InChI=1S/C13H14FN3O3/c14-10-3-1-9(2-4-10)8-20-16-11-5-6-12(7-11)17(19)13(15)18/h1-7,12,16,19H,8H2,(H2,15,18)/t12-/m0/s1 |
| InChIKey | DFZVHRNOEQQVPI-LBPRGKRZSA-N |
| XLogP | 1.44 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|