About benzyl 3-amino-2-iodopropanoate
benzyl 3-amino-2-iodopropanoate (PubChem CID 57172604) has the molecular formula C10H12INO2
and a molecular weight of 305.11 g/mol. Its IUPAC name is benzyl 3-amino-2-iodopropanoate.
Molecular Properties
| Compound Name | benzyl 3-amino-2-iodopropanoate |
| PubChem CID | 57172604 |
| Molecular Formula | C10H12INO2 |
| Molecular Weight | 305.11 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | benzyl 3-amino-2-iodopropanoate |
| SMILES | NCC(I)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H12INO2/c11-9(6-12)10(13)14-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2 |
| InChIKey | YLHADKFTZNSVAG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-amino-2-iodopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-amino-2-iodopropanoate?
The IUPAC name of benzyl 3-amino-2-iodopropanoate (CID 57172604) is benzyl 3-amino-2-iodopropanoate.
What is the SMILES notation for benzyl 3-amino-2-iodopropanoate?
The canonical SMILES for benzyl 3-amino-2-iodopropanoate is NCC(I)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-amino-2-iodopropanoate?
The InChIKey is YLHADKFTZNSVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12INO2/c11-9(6-12)10(13)14-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2.
What are the key properties of benzyl 3-amino-2-iodopropanoate?
benzyl 3-amino-2-iodopropanoate has a molecular weight of 305.11 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-amino-2-iodopropanoate is sourced from PubChem (CID 57172604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).