C28H33N7O — CID 57172673
N-[2-[6-[3-(4-benzylpiperazin-1-yl)propyl-methylamino]-3-pyridinyl]-1H-benzimidazol-4-yl]formamide (PubChem CID 57172673) has the molecular formula C28H33N7O and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[2-[6-[3-(4-benzylpiperazin-1-yl)propyl-methylamino]-3-pyridinyl]-1H-benzimidazol-4-yl]formamide.
| Compound Name | N-[2-[6-[3-(4-benzylpiperazin-1-yl)propyl-methylamino]-3-pyridinyl]-1H-benzimidazol-4-yl]formamide |
|---|---|
| PubChem CID | 57172673 |
| Molecular Formula | C28H33N7O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N-[2-[6-[3-(4-benzylpiperazin-1-yl)propyl-methylamino]-3-pyridinyl]-1H-benzimidazol-4-yl]formamide |
| SMILES | CN(CCCN1CCN(Cc2ccccc2)CC1)c1ccc(-c2nc3c(NC=O)cccc3[nH]2)cn1 |
| InChI | InChI=1S/C28H33N7O/c1-33(13-6-14-34-15-17-35(18-16-34)20-22-7-3-2-4-8-22)26-12-11-23(19-29-26)28-31-25-10-5-9-24(30-21-36)27(25)32-28/h2-5,7-12,19,21H,6,13-18,20H2,1H3,(H,30,36)(H,31,32) |
| InChIKey | BMFGJMBFMGVPOC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|