C19H35N3 — CID 57173343
N-[2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethyl]-N-propylpropan-1-amine (PubChem CID 57173343) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is N-[2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethyl]-N-propylpropan-1-amine.
| Compound Name | N-[2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 57173343 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | N-[2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CCC1CCN(C2(CC)C=CC=N2)CC1 |
| InChI | InChI=1S/C19H35N3/c1-4-13-21(14-5-2)15-8-18-9-16-22(17-10-18)19(6-3)11-7-12-20-19/h7,11-12,18H,4-6,8-10,13-17H2,1-3H3 |
| InChIKey | OQICYIGIMLHMGM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |