C21H34O2 — CID 57174110
(1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxylic acid (PubChem CID 57174110) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxylic acid.
| Compound Name | (1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxylic acid |
|---|---|
| PubChem CID | 57174110 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (1S,4S,9R,10S,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6-carboxylic acid |
| SMILES | C[C@@H]1C[C@]23CC[C@H]4C(C)(C)C(C(=O)O)CC[C@]4(C)[C@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C21H34O2/c1-13-11-21-10-8-16-19(2,3)15(18(22)23)7-9-20(16,4)17(21)6-5-14(13)12-21/h13-17H,5-12H2,1-4H3,(H,22,23)/t13-,14-,15?,16+,17-,20+,21+/m1/s1 |
| InChIKey | FXMIIIWNXSULKW-PSQLRSIFSA-N |
| XLogP | 5.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |