C21H32O3 — CID 90780329
(1S,4R,9R,10S,13R,14R)-6-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6-carboxylic acid (PubChem CID 90780329) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1S,4R,9R,10S,13R,14R)-6-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6-carboxylic acid.
| Compound Name | (1S,4R,9R,10S,13R,14R)-6-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 90780329 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1S,4R,9R,10S,13R,14R)-6-hydroxy-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6-carboxylic acid |
| SMILES | C[C@@H]1C[C@]23CC[C@H]4C(C)(C)C(O)(C(=O)O)C=C[C@]4(C)[C@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C21H32O3/c1-13-11-20-8-7-15-18(2,3)21(24,17(22)23)10-9-19(15,4)16(20)6-5-14(13)12-20/h9-10,13-16,24H,5-8,11-12H2,1-4H3,(H,22,23)/t13-,14-,15+,16-,19+,20+,21?/m1/s1 |
| InChIKey | NAZXLGXEMVJTEM-CHRVQPDCSA-N |
| XLogP | 4.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|