C23H36O3 — CID 140531256
[(1S,4S,9S,10R,13S,14R)-8-formyl-5,5,9,14-tetramethyl-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 140531256) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is [(1S,4S,9S,10R,13S,14R)-8-formyl-5,5,9,14-tetramethyl-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1S,4S,9S,10R,13S,14R)-8-formyl-5,5,9,14-tetramethyl-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 140531256 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | [(1S,4S,9S,10R,13S,14R)-8-formyl-5,5,9,14-tetramethyl-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | CC(=O)OC1(C=O)CCC(C)(C)[C@@H]2CC[C@]34C[C@H](CC[C@H]3[C@]21C)[C@H](C)C4 |
| InChI | InChI=1S/C23H36O3/c1-15-12-22-9-8-18-20(3,4)10-11-23(14-24,26-16(2)25)21(18,5)19(22)7-6-17(15)13-22/h14-15,17-19H,6-13H2,1-5H3/t15-,17+,18+,19+,21+,22+,23?/m1/s1 |
| InChIKey | GPBTZIGQJUFPDT-RBESFWFKSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|