C9H8N2O2 — CID 57176807
3-(3-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 57176807) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 57176807 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-(3-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cccc(-c2ncon2)c1 |
| InChI | InChI=1S/C9H8N2O2/c1-12-8-4-2-3-7(5-8)9-10-6-13-11-9/h2-6H,1H3 |
| InChIKey | GOAAWAXLKAJZNN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |