C14H27N3 — CID 57178709
5-(3-iminobutyl)decane-2,6-diimine (PubChem CID 57178709) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 5-(3-iminobutyl)decane-2,6-diimine.
| Compound Name | 5-(3-iminobutyl)decane-2,6-diimine |
|---|---|
| PubChem CID | 57178709 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 5-(3-iminobutyl)decane-2,6-diimine |
| SMILES | [H]/N=C(\C)CCC(CC/C(C)=N/[H])/C(CCCC)=N/[H] |
| InChI | InChI=1S/C14H27N3/c1-4-5-6-14(17)13(9-7-11(2)15)10-8-12(3)16/h13,15-17H,4-10H2,1-3H3/b15-11+,16-12+,17-14+ |
| InChIKey | OLECKCQVNZRTDZ-UKYUFSSYSA-N |
| XLogP | 4.45 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|