C16H27NO5 — CID 57178765
tert-butyl (4R)-4-(1-acetyloxy-2-methylprop-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 57178765) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is tert-butyl (4R)-4-(1-acetyloxy-2-methylprop-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-(1-acetyloxy-2-methylprop-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57178765 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | tert-butyl (4R)-4-(1-acetyloxy-2-methylprop-2-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C(C)C(OC(C)=O)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO5/c1-10(2)13(21-11(3)18)12-9-20-16(7,8)17(12)14(19)22-15(4,5)6/h12-13H,1,9H2,2-8H3/t12-,13?/m1/s1 |
| InChIKey | HBYZVIMXBGXQMG-PZORYLMUSA-N |
| XLogP | 2.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|