C22H38N2O6 — CID 57178853
ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-formylpyrrolidine-1,2-dicarboxylate (PubChem CID 57178853) has the molecular formula C22H38N2O6 and a molecular weight of 426.55 g/mol. Its IUPAC name is ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-formylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-formylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57178853 |
| Molecular Formula | C22H38N2O6 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-formylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@H]1[C@H](C=O)CC(C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38N2O6/c1-13(2)10-16(23-14(3)26)18-15(12-25)11-17(19(27)29-21(4,5)6)24(18)20(28)30-22(7,8)9/h12-13,15-18H,10-11H2,1-9H3,(H,23,26)/t15-,16-,17?,18+/m0/s1 |
| InChIKey | SQEIHJAZWYPUCJ-UKSPMXFCSA-N |
| XLogP | 3.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|