C23H39BrN2O6 — CID 11226152
ditert-butyl (2R,4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-bromoacetyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 11226152) has the molecular formula C23H39BrN2O6 and a molecular weight of 519.48 g/mol. Its IUPAC name is ditert-butyl (2R,4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-bromoacetyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-bromoacetyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11226152 |
| Molecular Formula | C23H39BrN2O6 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | ditert-butyl (2R,4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2-bromoacetyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@H]1[C@H](C(=O)CBr)C[C@H](C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39BrN2O6/c1-13(2)10-16(25-14(3)27)19-15(18(28)12-24)11-17(20(29)31-22(4,5)6)26(19)21(30)32-23(7,8)9/h13,15-17,19H,10-12H2,1-9H3,(H,25,27)/t15-,16-,17+,19+/m0/s1 |
| InChIKey | IAAHSYXRQYQRET-IMBTUZDBSA-N |
| XLogP | 3.84 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|