C14H18N4OS — CID 57180301
1-(furan-2-ylmethyl)-4-(1-methylpiperidin-3-yl)-1,3,5-triazine-2-thione (PubChem CID 57180301) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-(1-methylpiperidin-3-yl)-1,3,5-triazine-2-thione.
| Compound Name | 1-(furan-2-ylmethyl)-4-(1-methylpiperidin-3-yl)-1,3,5-triazine-2-thione |
|---|---|
| PubChem CID | 57180301 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-(1-methylpiperidin-3-yl)-1,3,5-triazine-2-thione |
| SMILES | CN1CCCC(c2ncn(Cc3ccco3)c(=S)n2)C1 |
| InChI | InChI=1S/C14H18N4OS/c1-17-6-2-4-11(8-17)13-15-10-18(14(20)16-13)9-12-5-3-7-19-12/h3,5,7,10-11H,2,4,6,8-9H2,1H3 |
| InChIKey | BBGDWUVWNSOIEN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|