C14H16N2O5 — CID 57180808
[3-[(2-methoxy-2-phenylacetyl)amino]-4-oxoazetidin-2-yl] acetate (PubChem CID 57180808) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is [3-[(2-methoxy-2-phenylacetyl)amino]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [3-[(2-methoxy-2-phenylacetyl)amino]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 57180808 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [3-[(2-methoxy-2-phenylacetyl)amino]-4-oxoazetidin-2-yl] acetate |
| SMILES | COC(C(=O)NC1C(=O)NC1OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O5/c1-8(17)21-14-10(12(18)16-14)15-13(19)11(20-2)9-6-4-3-5-7-9/h3-7,10-11,14H,1-2H3,(H,15,19)(H,16,18) |
| InChIKey | PRBDQZTUBSETJW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |