C15H15ClN2O6 — CID 54502130
methyl (2R,3R)-3-[[2-(2-chloroacetyl)oxy-2-phenylacetyl]amino]-4-oxoazetidine-2-carboxylate (PubChem CID 54502130) has the molecular formula C15H15ClN2O6 and a molecular weight of 354.75 g/mol. Its IUPAC name is methyl (2R,3R)-3-[[2-(2-chloroacetyl)oxy-2-phenylacetyl]amino]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl (2R,3R)-3-[[2-(2-chloroacetyl)oxy-2-phenylacetyl]amino]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 54502130 |
| Molecular Formula | C15H15ClN2O6 |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | methyl (2R,3R)-3-[[2-(2-chloroacetyl)oxy-2-phenylacetyl]amino]-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(=O)[C@@H]1NC(=O)C(OC(=O)CCl)c1ccccc1 |
| InChI | InChI=1S/C15H15ClN2O6/c1-23-15(22)11-10(13(20)18-11)17-14(21)12(24-9(19)7-16)8-5-3-2-4-6-8/h2-6,10-12H,7H2,1H3,(H,17,21)(H,18,20)/t10-,11-,12?/m1/s1 |
| InChIKey | YDDVFXPICWCGAD-XFKKCKKNSA-N |
| XLogP | -0.33 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|