C6H12OS — CID 57181017
4,4-dimethylthiolan-2-ol (PubChem CID 57181017) has the molecular formula C6H12OS and a molecular weight of 132.23 g/mol. Its IUPAC name is 4,4-dimethylthiolan-2-ol.
| Compound Name | 4,4-dimethylthiolan-2-ol |
|---|---|
| PubChem CID | 57181017 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 4,4-dimethylthiolan-2-ol |
| SMILES | CC1(C)CSC(O)C1 |
| InChI | InChI=1S/C6H12OS/c1-6(2)3-5(7)8-4-6/h5,7H,3-4H2,1-2H3 |
| InChIKey | QTCYGZSQDWPJQD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |