C17H23ClN2O3 — CID 57181196
tert-butyl 4-[(4-chlorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 57181196) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is tert-butyl 4-[(4-chlorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-chlorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 57181196 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | tert-butyl 4-[(4-chlorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(NOCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-17(2,3)23-16(21)20-10-8-15(9-11-20)19-22-12-13-4-6-14(18)7-5-13/h4-8,19H,9-12H2,1-3H3 |
| InChIKey | BEYWLJYEAXOIHF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|