C17H24N2O3 — CID 91129756
tert-butyl 5-(phenylmethoxyamino)-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 91129756) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl 5-(phenylmethoxyamino)-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-(phenylmethoxyamino)-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 91129756 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl 5-(phenylmethoxyamino)-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=C(NOCc2ccccc2)CCC1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)22-16(20)19-11-7-10-15(12-19)18-21-13-14-8-5-4-6-9-14/h4-6,8-9,12,18H,7,10-11,13H2,1-3H3 |
| InChIKey | LTHZONKSWIMIRR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|