About 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide
1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide (PubChem CID 57181447) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide |
| PubChem CID | 57181447 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide |
| SMILES | NC(=O)C1CCC(OCc2ccccc2)(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C21H24N2O3/c22-19(24)18-11-12-21(13-18,26-15-17-9-5-2-6-10-17)20(25)23-14-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H2,22,24)(H,23,25) |
| InChIKey | ZAHACMQLZGIOKH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide?
The IUPAC name of 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide (CID 57181447) is 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide.
What is the SMILES notation for 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide?
The canonical SMILES for 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide is NC(=O)C1CCC(OCc2ccccc2)(C(=O)NCc2ccccc2)C1.
What is the InChIKey of 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide?
The InChIKey is ZAHACMQLZGIOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c22-19(24)18-11-12-21(13-18,26-15-17-9-5-2-6-10-17)20(25)23-14-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H2,22,24)(H,23,25).
What are the key properties of 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide?
1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide has a molecular weight of 352.43 g/mol, XLogP of 2.54, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-benzyl-1-phenylmethoxycyclopentane-1,3-dicarboxamide is sourced from PubChem (CID 57181447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).