C19H23ClNO6S+ — CID 57181712
(1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(4-chlorobenzoyl)oxy-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57181712) has the molecular formula C19H23ClNO6S+ and a molecular weight of 428.91 g/mol. Its IUPAC name is (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(4-chlorobenzoyl)oxy-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(4-chlorobenzoyl)oxy-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57181712 |
| Molecular Formula | C19H23ClNO6S+ |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(4-chlorobenzoyl)oxy-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(C)C(=O)[N@@+]1(C(=O)O)C[C@H](OC(=O)c2ccc(Cl)cc2)C[C@H]1C |
| InChI | InChI=1S/C19H22ClNO6S/c1-11(10-28-13(3)22)17(23)21(19(25)26)9-16(8-12(21)2)27-18(24)14-4-6-15(20)7-5-14/h4-7,11-12,16H,8-10H2,1-3H3/p+1/t11?,12-,16-,21-/m1/s1 |
| InChIKey | KYCSLNIHKUMRDT-PGFXAKMASA-O |
| XLogP | 3.59 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|