C20H23F3NO6S+ — CID 57205565
(1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-[3-(trifluoromethyl)benzoyl]oxypyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57205565) has the molecular formula C20H23F3NO6S+ and a molecular weight of 462.47 g/mol. Its IUPAC name is (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-[3-(trifluoromethyl)benzoyl]oxypyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-[3-(trifluoromethyl)benzoyl]oxypyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57205565 |
| Molecular Formula | C20H23F3NO6S+ |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-[3-(trifluoromethyl)benzoyl]oxypyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(C)C(=O)[N@@+]1(C(=O)O)C[C@H](OC(=O)c2cccc(C(F)(F)F)c2)C[C@H]1C |
| InChI | InChI=1S/C20H22F3NO6S/c1-11(10-31-13(3)25)17(26)24(19(28)29)9-16(7-12(24)2)30-18(27)14-5-4-6-15(8-14)20(21,22)23/h4-6,8,11-12,16H,7,9-10H2,1-3H3/p+1/t11?,12-,16-,24-/m1/s1 |
| InChIKey | DNQVCZWGCDXNDK-ISXZVDHOSA-O |
| XLogP | 3.96 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|