C20H18F3NO4S — CID 90852164
(2S,4R)-4-benzoylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid (PubChem CID 90852164) has the molecular formula C20H18F3NO4S and a molecular weight of 425.43 g/mol. Its IUPAC name is (2S,4R)-4-benzoylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-4-benzoylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90852164 |
| Molecular Formula | C20H18F3NO4S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | (2S,4R)-4-benzoylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(S[C@@H]1C[C@@H](COCc2cc(F)c(F)cc2F)N(C(=O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C20H18F3NO4S/c21-16-8-18(23)17(22)6-13(16)10-28-11-14-7-15(9-24(14)20(26)27)29-19(25)12-4-2-1-3-5-12/h1-6,8,14-15H,7,9-11H2,(H,26,27)/t14-,15+/m0/s1 |
| InChIKey | YCPOICWIDLXNQY-LSDHHAIUSA-N |
| XLogP | 4.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|