C15H16F3NO4S — CID 91387363
(2S,4R)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid (PubChem CID 91387363) has the molecular formula C15H16F3NO4S and a molecular weight of 363.36 g/mol. Its IUPAC name is (2S,4R)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 91387363 |
| Molecular Formula | C15H16F3NO4S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (2S,4R)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC(=O)S[C@@H]1C[C@@H](COCc2cc(F)c(F)cc2F)N(C(=O)O)C1 |
| InChI | InChI=1S/C15H16F3NO4S/c1-8(20)24-11-3-10(19(5-11)15(21)22)7-23-6-9-2-13(17)14(18)4-12(9)16/h2,4,10-11H,3,5-7H2,1H3,(H,21,22)/t10-,11+/m0/s1 |
| InChIKey | IAQLJXRERYPVSP-WDEREUQCSA-N |
| XLogP | 3.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|