C17H22F3NO3S — CID 10156430
butyl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate (PubChem CID 10156430) has the molecular formula C17H22F3NO3S and a molecular weight of 377.43 g/mol. Its IUPAC name is butyl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | butyl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10156430 |
| Molecular Formula | C17H22F3NO3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | butyl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](S)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H22F3NO3S/c1-2-3-4-24-17(22)21-8-13(25)6-12(21)10-23-9-11-5-15(19)16(20)7-14(11)18/h5,7,12-13,25H,2-4,6,8-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | GZDRJFWCOUAROJ-QWHCGFSZSA-N |
| XLogP | 3.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|