C19H24F3NO4S — CID 86584853
tert-butyl (2R,4S)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate (PubChem CID 86584853) has the molecular formula C19H24F3NO4S and a molecular weight of 419.47 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86584853 |
| Molecular Formula | C19H24F3NO4S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | tert-butyl (2R,4S)-4-acetylsulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@H](COCc2cc(F)c(F)cc2F)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H24F3NO4S/c1-11(24)28-14-6-13(23(8-14)18(25)27-19(2,3)4)10-26-9-12-5-16(21)17(22)7-15(12)20/h5,7,13-14H,6,8-10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | WSZYNCJKZYOYBG-KGLIPLIRSA-N |
| XLogP | 4.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|