C18H22F3NO3S — CID 87831297
tert-butyl (3S,5S)-5-[(2,4,5-trifluorophenyl)methoxymethyl]-1-thia-6-azaspiro[2.4]heptane-6-carboxylate (PubChem CID 87831297) has the molecular formula C18H22F3NO3S and a molecular weight of 389.44 g/mol. Its IUPAC name is tert-butyl (3S,5S)-5-[(2,4,5-trifluorophenyl)methoxymethyl]-1-thia-6-azaspiro[2.4]heptane-6-carboxylate.
| Compound Name | tert-butyl (3S,5S)-5-[(2,4,5-trifluorophenyl)methoxymethyl]-1-thia-6-azaspiro[2.4]heptane-6-carboxylate |
|---|---|
| PubChem CID | 87831297 |
| Molecular Formula | C18H22F3NO3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | tert-butyl (3S,5S)-5-[(2,4,5-trifluorophenyl)methoxymethyl]-1-thia-6-azaspiro[2.4]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@]2(CS2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H22F3NO3S/c1-17(2,3)25-16(23)22-9-18(10-26-18)6-12(22)8-24-7-11-4-14(20)15(21)5-13(11)19/h4-5,12H,6-10H2,1-3H3/t12-,18-/m0/s1 |
| InChIKey | YULFJGTUVBMBSP-SGTLLEGYSA-N |
| XLogP | 4.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|