C36H36F3NO3S — CID 11786887
tert-butyl (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 11786887) has the molecular formula C36H36F3NO3S and a molecular weight of 619.75 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11786887 |
| Molecular Formula | C36H36F3NO3S |
| Molecular Weight | 619.75 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C36H36F3NO3S/c1-35(2,3)43-34(41)40-22-30(20-29(40)24-42-23-25-19-32(38)33(39)21-31(25)37)44-36(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-19,21,29-30H,20,22-24H2,1-3H3/t29-,30+/m0/s1 |
| InChIKey | SQNZXWCEBYTVBZ-XZWHSSHBSA-N |
| XLogP | 8.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.75 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|