C34H34F3NO3S — CID 141046896
(2S,4R)-4-(tribenzyl-λ4-sulfanyl)-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid (PubChem CID 141046896) has the molecular formula C34H34F3NO3S and a molecular weight of 593.71 g/mol. Its IUPAC name is (2S,4R)-4-(tribenzyl-λ4-sulfanyl)-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-4-(tribenzyl-λ4-sulfanyl)-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141046896 |
| Molecular Formula | C34H34F3NO3S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | (2S,4R)-4-(tribenzyl-λ4-sulfanyl)-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1C[C@H](S(Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C34H34F3NO3S/c35-31-18-33(37)32(36)16-28(31)20-41-21-29-17-30(19-38(29)34(39)40)42(22-25-10-4-1-5-11-25,23-26-12-6-2-7-13-26)24-27-14-8-3-9-15-27/h1-16,18,29-30H,17,19-24H2,(H,39,40)/t29-,30+/m0/s1 |
| InChIKey | SINJAKATZSKWQV-XZWHSSHBSA-N |
| XLogP | 8.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|