C23H30F3NO5S — CID 91316666
4-[2-[(2R)-2-[(3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 91316666) has the molecular formula C23H30F3NO5S and a molecular weight of 489.56 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-[(3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 91316666 |
| Molecular Formula | C23H30F3NO5S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 4-[2-[(2R)-2-[(3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)CC[C@@H]1C=C[C@@H](O)Cc1cccc(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C23H30F3NO5S/c24-23(25,26)16-32-15-18-4-1-3-17(13-18)14-20(28)8-6-19-7-9-21(29)27(19)10-12-33-11-2-5-22(30)31/h1,3-4,6,8,13,19-20,28H,2,5,7,9-12,14-16H2,(H,30,31)/t19-,20+/m0/s1 |
| InChIKey | MDPIKIYATKAQSN-VQTJNVASSA-N |
| XLogP | 3.81 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|