C26H31NO4S — CID 10026946
4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 10026946) has the molecular formula C26H31NO4S and a molecular weight of 453.60 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 10026946 |
| Molecular Formula | C26H31NO4S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-phenylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)CC[C@@H]1/C=C/[C@@H](O)Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H31NO4S/c28-24(19-20-6-4-9-22(18-20)21-7-2-1-3-8-21)13-11-23-12-14-25(29)27(23)15-17-32-16-5-10-26(30)31/h1-4,6-9,11,13,18,23-24,28H,5,10,12,14-17,19H2,(H,30,31)/b13-11+/t23-,24+/m0/s1 |
| InChIKey | KKFNXXORVOYZEM-KVKMCETFSA-N |
| XLogP | 4.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|