C17H14O2 — CID 57182675
6,8-dimethyl-2-phenylchromen-7-one (PubChem CID 57182675) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6,8-dimethyl-2-phenylchromen-7-one.
| Compound Name | 6,8-dimethyl-2-phenylchromen-7-one |
|---|---|
| PubChem CID | 57182675 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 6,8-dimethyl-2-phenylchromen-7-one |
| SMILES | Cc1cc2ccc(-c3ccccc3)oc-2c(C)c1=O |
| InChI | InChI=1S/C17H14O2/c1-11-10-14-8-9-15(13-6-4-3-5-7-13)19-17(14)12(2)16(11)18/h3-10H,1-2H3 |
| InChIKey | DRPZNLNSSRNDMG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |