C22H25NO4 — CID 57184074
benzyl (2R)-2-methyl-2-[(1S,2R,3R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]pyrrolidine-1-carboxylate (PubChem CID 57184074) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is benzyl (2R)-2-methyl-2-[(1S,2R,3R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-methyl-2-[(1S,2R,3R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57184074 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | benzyl (2R)-2-methyl-2-[(1S,2R,3R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]pyrrolidine-1-carboxylate |
| SMILES | C[C@]1([C@@H]2OC(=O)[C@@H]3[C@H]2[C@@H]2C=C[C@H]3C2)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c1-22(19-17-15-8-9-16(12-15)18(17)20(24)27-19)10-5-11-23(22)21(25)26-13-14-6-3-2-4-7-14/h2-4,6-9,15-19H,5,10-13H2,1H3/t15-,16+,17-,18+,19-,22-/m1/s1 |
| InChIKey | GKCMJZYFOVUHEN-RKSYFCQISA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|