C22H34N2O2 — CID 57185222
(3aS,3bS,9aS,9bR,11aR)-1-ethyl-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide (PubChem CID 57185222) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bR,11aR)-1-ethyl-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide.
| Compound Name | (3aS,3bS,9aS,9bR,11aR)-1-ethyl-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 57185222 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (3aS,3bS,9aS,9bR,11aR)-1-ethyl-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
| SMILES | CCC1CC[C@H]2[C@@H]3CCC4N(C)C(=O)C(C(N)=O)=C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C22H34N2O2/c1-5-13-6-8-16-14-7-9-18-22(3,17(14)10-11-21(13,16)2)12-15(19(23)25)20(26)24(18)4/h12-14,16-18H,5-11H2,1-4H3,(H2,23,25)/t13?,14-,16-,17+,18?,21+,22+/m0/s1 |
| InChIKey | CEGJYAXCFFSFLI-LPZVVZNUSA-N |
| XLogP | 3.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|