C12H21N5O2 — CID 57187110
(2S,5S)-2,5,9-triamino-1-(1H-imidazol-5-yl)nonane-3,4-dione (PubChem CID 57187110) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2S,5S)-2,5,9-triamino-1-(1H-imidazol-5-yl)nonane-3,4-dione.
| Compound Name | (2S,5S)-2,5,9-triamino-1-(1H-imidazol-5-yl)nonane-3,4-dione |
|---|---|
| PubChem CID | 57187110 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (2S,5S)-2,5,9-triamino-1-(1H-imidazol-5-yl)nonane-3,4-dione |
| SMILES | NCCCC[C@H](N)C(=O)C(=O)[C@@H](N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C12H21N5O2/c13-4-2-1-3-9(14)11(18)12(19)10(15)5-8-6-16-7-17-8/h6-7,9-10H,1-5,13-15H2,(H,16,17)/t9-,10-/m0/s1 |
| InChIKey | JAHKLUUTNQDOKB-UWVGGRQHSA-N |
| XLogP | -1.13 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|