C15H26N6O4 — CID 126634424
4,8-diamino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-methylamino]-3-oxooctanoic acid (PubChem CID 126634424) has the molecular formula C15H26N6O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4,8-diamino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-methylamino]-3-oxooctanoic acid.
| Compound Name | 4,8-diamino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-methylamino]-3-oxooctanoic acid |
|---|---|
| PubChem CID | 126634424 |
| Molecular Formula | C15H26N6O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4,8-diamino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-methylamino]-3-oxooctanoic acid |
| SMILES | CN(C(=O)C(N)Cc1cnc[nH]1)C(C(=O)O)C(=O)C(N)CCCCN |
| InChI | InChI=1S/C15H26N6O4/c1-21(14(23)11(18)6-9-7-19-8-20-9)12(15(24)25)13(22)10(17)4-2-3-5-16/h7-8,10-12H,2-6,16-18H2,1H3,(H,19,20)(H,24,25) |
| InChIKey | RAEUWNQDFHXIEW-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 181.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|