C18H26N3OPS2 — CID 57188233
N-diaminophosphoryl-2-(4-methylsulfanylphenyl)-N-[2-(4-methylsulfanylphenyl)ethyl]ethanamine (PubChem CID 57188233) has the molecular formula C18H26N3OPS2 and a molecular weight of 395.53 g/mol. Its IUPAC name is N-diaminophosphoryl-2-(4-methylsulfanylphenyl)-N-[2-(4-methylsulfanylphenyl)ethyl]ethanamine.
| Compound Name | N-diaminophosphoryl-2-(4-methylsulfanylphenyl)-N-[2-(4-methylsulfanylphenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 57188233 |
| Molecular Formula | C18H26N3OPS2 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-diaminophosphoryl-2-(4-methylsulfanylphenyl)-N-[2-(4-methylsulfanylphenyl)ethyl]ethanamine |
| SMILES | CSc1ccc(CCN(CCc2ccc(SC)cc2)P(N)(N)=O)cc1 |
| InChI | InChI=1S/C18H26N3OPS2/c1-24-17-7-3-15(4-8-17)11-13-21(23(19,20)22)14-12-16-5-9-18(25-2)10-6-16/h3-10H,11-14H2,1-2H3,(H4,19,20,22) |
| InChIKey | FOGDWIHFTIBNKC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|