C16H22 — CID 57188344
7-methyl-1,2-di(propan-2-yl)-1H-indene (PubChem CID 57188344) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 7-methyl-1,2-di(propan-2-yl)-1H-indene.
| Compound Name | 7-methyl-1,2-di(propan-2-yl)-1H-indene |
|---|---|
| PubChem CID | 57188344 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 7-methyl-1,2-di(propan-2-yl)-1H-indene |
| SMILES | Cc1cccc2c1C(C(C)C)C(C(C)C)=C2 |
| InChI | InChI=1S/C16H22/c1-10(2)14-9-13-8-6-7-12(5)16(13)15(14)11(3)4/h6-11,15H,1-5H3 |
| InChIKey | HYNUFMQOWJSBIV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |