C21H21ClF3NO — CID 57190002
1-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-3-(1,1,1-trifluorobutan-2-yl)indole (PubChem CID 57190002) has the molecular formula C21H21ClF3NO and a molecular weight of 395.85 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-3-(1,1,1-trifluorobutan-2-yl)indole.
| Compound Name | 1-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-3-(1,1,1-trifluorobutan-2-yl)indole |
|---|---|
| PubChem CID | 57190002 |
| Molecular Formula | C21H21ClF3NO |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-3-(1,1,1-trifluorobutan-2-yl)indole |
| SMILES | CCC(c1c(C)n(Cc2ccc(Cl)cc2)c2ccc(OC)cc12)C(F)(F)F |
| InChI | InChI=1S/C21H21ClF3NO/c1-4-18(21(23,24)25)20-13(2)26(12-14-5-7-15(22)8-6-14)19-10-9-16(27-3)11-17(19)20/h5-11,18H,4,12H2,1-3H3 |
| InChIKey | VYCIGBAWVTYUFJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|